N-(7-chloro-5-methyl-1,8-naphthyridin-2-yl)acetamide structure
|
Common Name | N-(7-chloro-5-methyl-1,8-naphthyridin-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 1569-34-2 | Molecular Weight | 235.67000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(7-chloro-5-methyl-1,8-naphthyridin-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10ClN3O |
|---|---|
| Molecular Weight | 235.67000 |
| Exact Mass | 235.05100 |
| PSA | 58.37000 |
| LogP | 3.19950 |
| InChIKey | HEWSVFVOJBURFZ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2c(C)cc(Cl)nc2n1 |
|
~%
N-(7-chloro-5-m... CAS#:1569-34-2 |
| Literature: The United States of America as represented by the Secretary of the Navy Patent: US4202981 A1, 1980 ; |
| N-(7-Chloro-5-methyl-[1,8]naphthyridin-2-yl)-acetamide |
| Acetamide,N-(7-chloro-5-methyl-1,8-naphthyridin-2-yl) |
| 7-Acetamido-2-chloro-4-methyl-1,8-naphthyridine |
| 2-acetamido-5-methyl-7-chloro-1,8-naphthyridine |
| 2-chloro-4-methyl-7-acetylamino-1,8-naphthyrine |
| N-(7-Chlor-5-methyl-[1,8]naphthyridin-2-yl)-acetamid |
| 2-Chlor-7-acetamino-4-methyl-1,8-naphthyridin |