5,7-Di-2-thienylthieno[3,4-b]pyrazine
Modify Date: 2025-10-24 16:49:45
![5,7-Di-2-thienylthieno[3,4-b]pyrazine Structure](https://www.chemsrc.com/extcaspic/065/156645-42-0.png)
5,7-Di-2-thienylthieno[3,4-b]pyrazine structure
|
Common Name | 5,7-Di-2-thienylthieno[3,4-b]pyrazine | ||
|---|---|---|---|---|
| CAS Number | 156645-42-0 | Molecular Weight | 300.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8N2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,7-Di-2-thienylthieno[3,4-b]pyrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H8N2S3 |
|---|---|
| Molecular Weight | 300.4 |
| InChIKey | FQDGUWXAKHTHRK-UHFFFAOYSA-N |
| SMILES | c1csc(-c2sc(-c3cccs3)c3nccnc23)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5,7-Di-2-thienylthieno[3,4-b]pyrazine? |
| A: InChIKey of 5,7-Di-2-thienylthieno[3,4-b]pyrazine is FQDGUWXAKHTHRK-UHFFFAOYSA-N. |
| Q: What is the English name of 5,7-Di-2-thienylthieno[3,4-b]pyrazine? |
| A: The English name of 5,7-Di-2-thienylthieno[3,4-b]pyrazine is 5,7-Di-2-thienylthieno[3,4-b]pyrazine. |
| Q: What is the molecular weight of 5,7-Di-2-thienylthieno[3,4-b]pyrazine? |
| A: Molecular weight of 5,7-Di-2-thienylthieno[3,4-b]pyrazine is 300.4. |
| Q: What is the molecular formula of 5,7-Di-2-thienylthieno[3,4-b]pyrazine? |
| A: Molecular formula of 5,7-Di-2-thienylthieno[3,4-b]pyrazine is C14H8N2S3. |
| Q: What is the Chinese name of 156645-42-0? |
| A: Chinese name of 156645-42-0 is 156645-42-0. |
| Q: What is the CAS number of 5,7-Di-2-thienylthieno[3,4-b]pyrazine? |
| A: CAS number of 5,7-Di-2-thienylthieno[3,4-b]pyrazine is 156645-42-0. |
| Q: What is the SMILES notation of 5,7-Di-2-thienylthieno[3,4-b]pyrazine? |
| A: SMILES notation of 5,7-Di-2-thienylthieno[3,4-b]pyrazine is c1csc(-c2sc(-c3cccs3)c3nccnc23)c1. |