2-Propen-1-one,1-(4-fluorophenyl)-3-(2-furanyl)- structure
|
Common Name | 2-Propen-1-one,1-(4-fluorophenyl)-3-(2-furanyl)- | ||
|---|---|---|---|---|
| CAS Number | 1565-90-8 | Molecular Weight | 216.20800 | |
| Density | 1.169g/cm3 | Boiling Point | 333.7ºC at 760mmHg | |
| Molecular Formula | C13H9FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.6ºC | |
| Name | (E)-1-(4-fluorophenyl)-3-(furan-2-yl)prop-2-en-1-one |
|---|
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 333.7ºC at 760mmHg |
| Molecular Formula | C13H9FO2 |
| Molecular Weight | 216.20800 |
| Flash Point | 155.6ºC |
| Exact Mass | 216.05900 |
| PSA | 30.21000 |
| LogP | 3.31480 |
| Vapour Pressure | 0.000174mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | BGWADTFLQQUACM-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1ccco1)c1ccc(F)cc1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |