Losartan-hydrochlorothiazide mixture
Modify Date: 2025-08-24 22:04:44
Losartan-hydrochlorothiazide mixture structure
|
Common Name | Losartan-hydrochlorothiazide mixture | ||
|---|---|---|---|---|
| CAS Number | 156154-37-9 | Molecular Weight | 758.74000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H30Cl2KN9O5S2 | Melting Point | 183.5-184.5ºC /Losartan/ | |
| MSDS | N/A | Flash Point | N/A | |
| Name | potassium,[2-butyl-5-chloro-3-[[4-[2-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol,6-chloro-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 183.5-184.5ºC /Losartan/ |
|---|---|
| Molecular Formula | C29H30Cl2KN9O5S2 |
| Molecular Weight | 758.74000 |
| Exact Mass | 757.08300 |
| PSA | 210.25000 |
| LogP | 6.11750 |
| InChIKey | XRKMYXDEMOEFBN-UHFFFAOYSA-N |
| SMILES | CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2-c2nnn[n-]2)cc1.NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O.[K+] |
| 2H-1,2,4-Benzothiadiazine-7-sulfonamide,6-chloro-3,4-dihydro-,1,1-dioxide,mixt with 2-butyl-4-chloro-1-((2'-(1H-tetrazol-5-yl)(1,1'-biphenyl)-4-yl)methyl)-1H-imidazole-5-methanol |
| losartan potassium and hydrochlorothiazide |
| Losartan mixture with Hydrochlorothiazide |
| Losartan-hydrochlorothiazide mixt |
| Preminent |