7-Chloro-2-[[2-(dimethylamino)-1-methylethyl]thio]-3-phenylquinazolin-4(3H)-one structure
|
Common Name | 7-Chloro-2-[[2-(dimethylamino)-1-methylethyl]thio]-3-phenylquinazolin-4(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 15589-23-8 | Molecular Weight | 373.90000 | |
| Density | 1.25g/cm3 | Boiling Point | 514.4ºC at 760 mmHg | |
| Molecular Formula | C19H20ClN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.9ºC | |
| Name | 7-chloro-2-[1-(dimethylamino)propan-2-ylsulfanyl]-3-phenylquinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 514.4ºC at 760 mmHg |
| Molecular Formula | C19H20ClN3OS |
| Molecular Weight | 373.90000 |
| Flash Point | 264.9ºC |
| Exact Mass | 373.10200 |
| PSA | 63.43000 |
| LogP | 4.08130 |
| Vapour Pressure | 1.09E-10mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | BYYFDPICODWISQ-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)Sc1nc2cc(Cl)ccc2c(=O)n1-c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Chloro-2-((2-(dimethylamino)-1-methylethyl)thio)-3-phenyl-4(3H)-quinazolinone |
| 7-Chlor-4-oxo-3-phenyl-2-(2-dimethylamino-1-methyl-aethylmercapto)-3,4-dihydro-chinazolin |
| 7-chloro-2-{[1-(dimethylamino)propan-2-yl]sulfanyl}-3-phenylquinazolin-4(3H)-one |
| 7-chloro-2-(2-dimethylamino-1-methyl-ethylsulfanyl)-3-phenyl-3H-quinazolin-4-one |
| 4(3H)-Quinazolinone,7-chloro-2-((2-(dimethylamino)-1-methylethyl)thio)-3-phenyl |