ethyl (E)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-enoate
Modify Date: 2025-08-24 11:18:54
ethyl (E)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-enoate structure
|
Common Name | ethyl (E)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 155401-23-3 | Molecular Weight | 222.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl (E)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-enoate |
|---|
| Molecular Formula | C12H14O4 |
|---|---|
| Molecular Weight | 222.23700 |
| Exact Mass | 222.08900 |
| PSA | 55.76000 |
| LogP | 1.97710 |
| InChIKey | ONOCGKVKAPMGRX-FNORWQNLSA-N |
| SMILES | CCOC(=O)C=Cc1ccc(OC)c(O)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |