4-(4-carbamimidoylanilino)benzenecarboximidamide structure
|
Common Name | 4-(4-carbamimidoylanilino)benzenecarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 15535-96-3 | Molecular Weight | 253.30200 | |
| Density | N/A | Boiling Point | 446.4ºC at 760 mmHg | |
| Molecular Formula | C14H15N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.8ºC | |
| Name | 4-(4-carbamimidoylanilino)benzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 446.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.30200 |
| Flash Point | 223.8ºC |
| Exact Mass | 253.13300 |
| PSA | 111.77000 |
| LogP | 3.67140 |
| Vapour Pressure | 3.67E-08mmHg at 25°C |
| InChIKey | OOSANNOCGQRXSP-UHFFFAOYSA-N |
| SMILES | N=C(N)c1ccc(Nc2ccc(C(=N)N)cc2)cc1 |
| HS Code | 2925290090 |
|---|
|
~%
4-(4-carbamimid... CAS#:15535-96-3 |
| Literature: Ashley et al. Journal of the Chemical Society, 1942 , p. 103,107 |
|
~%
4-(4-carbamimid... CAS#:15535-96-3 |
| Literature: Ashley et al. Journal of the Chemical Society, 1942 , p. 103,107 |
|
~%
4-(4-carbamimid... CAS#:15535-96-3 |
| Literature: Ashley et al. Journal of the Chemical Society, 1942 , p. 103,107 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4,4'-diamidinodiphenylamine |
| diamidinodiphenylamine |
| 4,4'-imino-bis-benzamidine |
| 4,4'-iminodibenzenecarboximidamide |
| EINECS 239-582-8 |
| 4,4'-iminodibenzamidine |
| 4,4'-Imino-bis-benzamidin |
| Bis-(4-carbamimidoyl-phenyl)-amin |