2-(2-(tert-Butoxycarbonyl)hydrazinyl)benzoic acid
Modify Date: 2025-10-20 16:46:23
2-(2-(tert-Butoxycarbonyl)hydrazinyl)benzoic acid structure
|
Common Name | 2-(2-(tert-Butoxycarbonyl)hydrazinyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 155290-47-4 | Molecular Weight | 252.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-(tert-Butoxycarbonyl)hydrazinyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16N2O4 |
|---|---|
| Molecular Weight | 252.26600 |
| Exact Mass | 252.11100 |
| PSA | 87.66000 |
| LogP | 2.70030 |
| InChIKey | DTTSVUPYGSOJER-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNc1ccccc1C(=O)O |
| HS Code | 2928000090 |
|---|
|
~93%
2-(2-(tert-Buto... CAS#:155290-47-4 |
| Literature: CENTRE NATIONAL DE LA RECHERCHE SCIENTIFIQUE; UNIVERSITE CLAUDE BERNARD LYON I Patent: US2012/10161 A1, 2012 ; Location in patent: Page/Page column 11 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(2'-N-Boc-hydrazino)benzoic acid |
| 2-[2-(tert-Butoxycarbonyl)hydrazino]benzoic acid |
| 2-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]benzoic acid |