FXIa-IN-6
Modify Date: 2024-08-30 08:51:00
FXIa-IN-6 structure
|
Common Name | FXIa-IN-6 | ||
|---|---|---|---|---|
| CAS Number | 1551460-43-5 | Molecular Weight | 595.04 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H29ClF2N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FXIa-IN-6FXIa-IN-6 is a potent FXIa inhibitor with selectivity against most of the relevant serine proteases (Ki = 0.3 nM). |
| Name | FXIa-IN-6 |
|---|
| Description | FXIa-IN-6 is a potent FXIa inhibitor with selectivity against most of the relevant serine proteases (Ki = 0.3 nM). |
|---|
| Molecular Formula | C31H29ClF2N4O4 |
|---|---|
| Molecular Weight | 595.04 |
| InChIKey | AXXYATYQRMPQSN-WGDIFIGCSA-N |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)C(C)CCCC(N1CCC(c3c(F)ccc(Cl)c3F)=CC1=O)c1cc-2ccn1 |