2-Octanol,1-bromo-1-nitro- structure
|
Common Name | 2-Octanol,1-bromo-1-nitro- | ||
|---|---|---|---|---|
| CAS Number | 15509-51-0 | Molecular Weight | 254.12200 | |
| Density | 1.375g/cm3 | Boiling Point | 304.2ºC at 760mmHg | |
| Molecular Formula | C8H16BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.8ºC | |
| Name | 1-bromo-1-nitrooctan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 304.2ºC at 760mmHg |
| Molecular Formula | C8H16BrNO3 |
| Molecular Weight | 254.12200 |
| Flash Point | 137.8ºC |
| Exact Mass | 253.03100 |
| PSA | 66.05000 |
| LogP | 2.83860 |
| Vapour Pressure | 8.44E-05mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | GWNCZMMMYVYUCI-UHFFFAOYSA-N |
| SMILES | CCCCCCC(O)C(Br)[N+](=O)[O-] |
| HS Code | 2905590090 |
|---|
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-Octanol,1-bromo-1-nitro |
| 1-BROMO-1-NITRO-OCTAN-2-OL |