Tropine 2-(phenylthio)butanoate oxalate salt
Modify Date: 2025-09-14 19:25:14
Tropine 2-(phenylthio)butanoate oxalate salt structure
|
Common Name | Tropine 2-(phenylthio)butanoate oxalate salt | ||
|---|---|---|---|---|
| CAS Number | 155059-55-5 | Molecular Weight | 409.49600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H27NO6S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | Tropine 2-(phenylthio)butanoate oxalate salt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H27NO6S |
|---|---|
| Molecular Weight | 409.49600 |
| Exact Mass | 409.15600 |
| PSA | 129.44000 |
| LogP | 2.81920 |
| InChIKey | DBBVWGGNICLTMF-UHFFFAOYSA-N |
| SMILES | CCC(Sc1ccccc1)C(=O)OC1CC2CCC(C1)N2C.O=C(O)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Presynaptic cholinergic modulators as potent cognition enhancers and analgesic drugs. 1. Tropic and 2-phenylpropionic acid esters.
J. Med. Chem. 37 , 1704, (1994) Previous studies have shown that (R)-(+)-hyoscyamine has analgesic activity as a consequence of increased ACh release following antagonism of central muscarinic autoreceptors. Since the enhancement of... |
| sm32 |