N-[4-[[3-(Dimethylamino)propyl]amino]-5-oxo-1,3,6-cycloheptatrien-1-yl]acetamide structure
|
Common Name | N-[4-[[3-(Dimethylamino)propyl]amino]-5-oxo-1,3,6-cycloheptatrien-1-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 15499-15-7 | Molecular Weight | 263.33500 | |
| Density | 1.11g/cm3 | Boiling Point | 448.1ºC at 760mmHg | |
| Molecular Formula | C14H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.8ºC | |
| Name | N-[4-[3-(dimethylamino)propylamino]-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 448.1ºC at 760mmHg |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.33500 |
| Flash Point | 224.8ºC |
| Exact Mass | 263.16300 |
| PSA | 64.93000 |
| LogP | 2.09130 |
| Vapour Pressure | 3.2E-08mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | MGBMBEHKCRQFGA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(NCCCN(C)C)c(=O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetamide,N-(4-((3-(dimethylamino)propyl)amino)-5-oxo-1,3,6-cycloheptatrien-1-yl) |
| 2-(3-Dimethylamino-propylamino)-5-acetamino-1-oxo-cycloheptatrien-(2,4,6) |
| LS-9335 |
| N-(4-((3-(Dimethylamino)propyl)amino)-5-oxo-1,3,6-cycloheptatrien-1-yl)acetamide |
| (2-(3-Dimethylaminopropylamino)-5-acetamido)tropone |