2-(4-Chlorophenyl)-1-(2,4-dihydroxyphenyl)ethanone structure
|
Common Name | 2-(4-Chlorophenyl)-1-(2,4-dihydroxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 15485-64-0 | Molecular Weight | 262.68800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-Chlorophenyl)-1-(2,4-dihydroxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11ClO3 |
|---|---|
| Molecular Weight | 262.68800 |
| Exact Mass | 262.04000 |
| PSA | 57.53000 |
| LogP | 3.17660 |
| InChIKey | OOSNDHMLIFRVBM-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc(Cl)cc1)c1ccc(O)cc1O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4'-chloro-2,4-dihydroxy-deoxybenzoin |
| 4'-Chlor-2,4-dihydroxy-desoxybenzoin |