S-[benzoylsulfanyl(dioctyl)stannyl] benzenecarbothioate
Modify Date: 2025-10-12 21:07:00
![S-[benzoylsulfanyl(dioctyl)stannyl] benzenecarbothioate Structure](https://image.chemsrc.com/caspic/185/15481-47-7.png)
S-[benzoylsulfanyl(dioctyl)stannyl] benzenecarbothioate structure
|
Common Name | S-[benzoylsulfanyl(dioctyl)stannyl] benzenecarbothioate | ||
|---|---|---|---|---|
| CAS Number | 15481-47-7 | Molecular Weight | 619.50000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H44O2S2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-[benzoylsulfanyl(dioctyl)stannyl] benzenecarbothioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H44O2S2Sn |
|---|---|
| Molecular Weight | 619.50000 |
| Exact Mass | 620.18000 |
| PSA | 34.14000 |
| LogP | 8.72860 |
| InChIKey | PLIJRLOOGIUVIU-UHFFFAOYSA-L |
| SMILES | CCCCCCCC[Sn](CCCCCCCC)(SC(=O)c1ccccc1)SC(=O)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Benzoicacid,thio-,S,S'-(dioctylstannylene) deriv. (8CI) |
| Bis(benzoylthio)dioctylstannane |
| EINECS 239-502-1 |
| Stannane,bis(benzoylthio)dioctyl-(8CI,9CI) |