N-(3,4-Dichlorophenyl)-1-aziridinecarboxamide structure
|
Common Name | N-(3,4-Dichlorophenyl)-1-aziridinecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 15460-48-7 | Molecular Weight | 231.07900 | |
| Density | 1.574g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H8Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3,4-dichlorophenyl)aziridine-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.574g/cm3 |
|---|---|
| Molecular Formula | C9H8Cl2N2O |
| Molecular Weight | 231.07900 |
| Exact Mass | 230.00100 |
| PSA | 35.60000 |
| LogP | 2.79240 |
| Index of Refraction | 1.693 |
| InChIKey | RLYVLFBGLUBQDO-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1CC1 |
| HS Code | 2933990090 |
|---|
|
~%
N-(3,4-Dichloro... CAS#:15460-48-7 |
| Literature: Dow Chem. Co. Patent: US2775587 , 1955 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| aziridine-1-carboxylic acid 3,4-dichloro-anilide |
| N-(3,4-Dichlorphenylcarbamoyl)aziridin |
| 3,4-Dichlorophenyl-N-carbamoylaziridine |
| N'-(3,4-Dichlorphenyl)-N,N-ethylenharnstoff |
| 1-AZIRIDINECARBOXAMIDE,N-(3,4-DICHLOROPHENYL) |
| N-(3,4-Dichlorophenyl)-1-aziridinecarboxamide |
| Aziridin-1-carbonsaeure-(3,4-dichlor-anilid) |
| 1-<3,4-Dichlor-phenylcarbamoyl>-aziridin |
| N-(3,4-dichlorophenylcarbamoyl)aziridine |