AKOS BBS-00008108
Modify Date: 2025-09-26 13:05:36
AKOS BBS-00008108 structure
|
Common Name | AKOS BBS-00008108 | ||
|---|---|---|---|---|
| CAS Number | 15460-12-5 | Molecular Weight | 308.01000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dibromo-6-tert-butylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12Br2O |
|---|---|
| Molecular Weight | 308.01000 |
| Exact Mass | 305.92500 |
| PSA | 20.23000 |
| LogP | 4.21470 |
| InChIKey | KSURDFVRHGKTAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Br)cc(Br)c1O |
| HS Code | 2908199090 |
|---|
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 2,4-dibromo-6-(tert-butyl)phenol |
| 4,6-dibromo-2-t-butyl phenol |
| 2,4-dibromo-6-t-butylphenol |