Phenol,2,4,6-trichloro-3-ethyl-5-methyl- structure
|
Common Name | Phenol,2,4,6-trichloro-3-ethyl-5-methyl- | ||
|---|---|---|---|---|
| CAS Number | 15460-04-5 | Molecular Weight | 239.52600 | |
| Density | 1.386g/cm3 | Boiling Point | 289.4ºC at 760mmHg | |
| Molecular Formula | C9H9Cl3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.8ºC | |
| Name | 2,4,6-trichloro-3-ethyl-5-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 289.4ºC at 760mmHg |
| Molecular Formula | C9H9Cl3O |
| Molecular Weight | 239.52600 |
| Flash Point | 128.8ºC |
| Exact Mass | 237.97200 |
| PSA | 20.23000 |
| LogP | 4.22320 |
| Vapour Pressure | 0.00127mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | RXOQFAHAWHYIOQ-UHFFFAOYSA-N |
| SMILES | CCc1c(Cl)c(C)c(Cl)c(O)c1Cl |
| HS Code | 2908199090 |
|---|
|
~%
Phenol,2,4,6-tr... CAS#:15460-04-5 |
| Literature: Lamartine,R.; Perrin,R. Journal of Organic Chemistry, 1974 , vol. 39, # 12 p. 1744 - 1748 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 3-ETHYL-5-METHYL-2,4,6-TRICHLOROPHENOL |
| 2,4,6-Trichlor-3-methyl-5-ethylphenol |
| 3-Ethyl-5-methyl-2,4,6-trichlor-phenol |