2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]acetic acid
Modify Date: 2025-09-18 15:36:30
![2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]acetic acid Structure](https://image.chemsrc.com/caspic/083/154509-63-4.png)
2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]acetic acid structure
|
Common Name | 2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 154509-63-4 | Molecular Weight | 217.26200 | |
| Density | 1.089g/cm3 | Boiling Point | 312.4ºC at 760mmHg | |
| Molecular Formula | C10H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.7ºC | |
| Name | 2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 312.4ºC at 760mmHg |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26200 |
| Flash Point | 142.7ºC |
| Exact Mass | 217.13100 |
| PSA | 66.84000 |
| LogP | 1.71650 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | VDWLWSLMCAPRCS-UHFFFAOYSA-N |
| SMILES | CC(C)N(CC(=O)O)C(=O)OC(C)(C)C |
| HS Code | 2924299090 |
|---|
|
~%
2-[(2-methylpro... CAS#:154509-63-4 |
| Literature: Mouna; Nguyen; Rage; Xie; Nee; Mazaleyrat; Wakselman Synthetic Communications, 1994 , vol. 24, # 17 p. 2429 - 2435 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n-boc-n-isopropyl-amino-acetic acid |