4-Benzoyl-3-hydroxyphenyl acrylate
Modify Date: 2025-08-23 09:20:58
4-Benzoyl-3-hydroxyphenyl acrylate structure
|
Common Name | 4-Benzoyl-3-hydroxyphenyl acrylate | ||
|---|---|---|---|---|
| CAS Number | 15419-94-0 | Molecular Weight | 268.264 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 427.0±38.0 °C at 760 mmHg | |
| Molecular Formula | C16H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.1±20.3 °C | |
| Name | (4-benzoyl-3-hydroxyphenyl) prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 427.0±38.0 °C at 760 mmHg |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.264 |
| Flash Point | 159.1±20.3 °C |
| Exact Mass | 268.073547 |
| PSA | 63.60000 |
| LogP | 3.62 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | LJWQJECMFUGUDV-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Oc1ccc(C(=O)c2ccccc2)c(O)c1 |
| HS Code | 2916129000 |
|---|
| HS Code | 2916129000 |
|---|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Propenoic acid, 4-benzoyl-3-hydroxyphenyl ester |
| 4-acryloyloxy-2-hydroxybenzophenone |
| 4-Benzoyl-3-hydroxyphenyl acrylate |
| 2-Hydroxy-4-acryloyloxybenzophenone |
| 2-hydroxy-4-(acryloyloxy)benzophenone |