Isokotanin B
Modify Date: 2025-09-21 17:34:23
Isokotanin B structure
|
Common Name | Isokotanin B | ||
|---|---|---|---|---|
| CAS Number | 154160-09-5 | Molecular Weight | 424.400 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 647.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H20O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.7±25.0 °C | |
Use of Isokotanin BIsokotanin B is a metabolite of bicoumarin isolated from the sclerotia of Aspergillus alliaceus. Isokotanin B shows activity against the corn earworm Helicoverpa zea and the dried fruit bettle Carpophilus hemipterus[1]. |
| Name | Isokotanin B |
|---|---|
| Synonym | More Synonyms |
| Description | Isokotanin B is a metabolite of bicoumarin isolated from the sclerotia of Aspergillus alliaceus. Isokotanin B shows activity against the corn earworm Helicoverpa zea and the dried fruit bettle Carpophilus hemipterus[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 647.1±55.0 °C at 760 mmHg |
| Molecular Formula | C23H20O8 |
| Molecular Weight | 424.400 |
| Flash Point | 226.7±25.0 °C |
| Exact Mass | 424.115814 |
| LogP | 3.48 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | SFRGEKKETJXWMS-UHFFFAOYSA-N |
| SMILES | COc1cc2oc(=O)cc(OC)c2c(C)c1-c1c(O)cc2oc(=O)cc(OC)c2c1C |
| [6,6'-Bi-2H-1-benzopyran]-2,2'-dione, 7-hydroxy-4,4',7'-trimethoxy-5,5'-dimethyl- |
| 7-Hydroxy-4,4',7'-trimethoxy-5,5'-dimethyl-2H,2'H-6,6'-bichromene-2,2'-dione |
| Isokotanin B |