6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride
Modify Date: 2025-09-02 11:47:18
6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride structure
|
Common Name | 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1541069-38-8 | Molecular Weight | 251.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8Cl2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8Cl2O2S |
|---|---|
| Molecular Weight | 251.13 |
| InChIKey | CYKNYGHIXWWPMQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cc2c(cc1Cl)CCC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride? |
| A: Molecular weight of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride is 251.13. |
| Q: What is the Chinese name of 1541069-38-8? |
| A: Chinese name of 1541069-38-8 is 1541069-38-8. |
| Q: What is the molecular formula of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride? |
| A: Molecular formula of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride is C9H8Cl2O2S. |
| Q: What is the English name of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride? |
| A: The English name of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride is 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride. |
| Q: What is the SMILES notation of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride? |
| A: SMILES notation of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride is O=S(=O)(Cl)c1cc2c(cc1Cl)CCC2. |
| Q: What is the InChIKey of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride? |
| A: InChIKey of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride is CYKNYGHIXWWPMQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride? |
| A: CAS number of 6-Chloro-2,3-dihydro-1H-indene-5-sulfonyl chloride is 1541069-38-8. |