2-naphthalen-2-ylbutanoic acid structure
|
Common Name | 2-naphthalen-2-ylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 15410-83-0 | Molecular Weight | 214.26000 | |
| Density | 1.159g/cm3 | Boiling Point | 378.8ºC at 760mmHg | |
| Molecular Formula | C14H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.6ºC | |
| Name | 2-naphthalen-2-ylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 378.8ºC at 760mmHg |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26000 |
| Flash Point | 275.6ºC |
| Exact Mass | 214.09900 |
| PSA | 37.30000 |
| LogP | 3.41800 |
| Vapour Pressure | 2.06E-06mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | BKYOHEHDQWPGOY-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)c1ccc2ccccc2c1 |
|
~%
2-naphthalen-2-... CAS#:15410-83-0 |
| Literature: Stivala, Craig E.; Zakarian, Armen Journal of the American Chemical Society, 2011 , vol. 133, # 31 p. 11936 - 11939 |
| 2-(Naphthyl-2)-buttersaeure |
| 2-(naphthalen-2-yl)butanoic acid |