gentiacaulein structure
|
Common Name | gentiacaulein | ||
|---|---|---|---|---|
| CAS Number | 15402-27-4 | Molecular Weight | 288.25200 | |
| Density | 1.452g/cm3 | Boiling Point | 546.3ºC at 760 mmHg | |
| Molecular Formula | C15H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.6ºC | |
| Name | gentiacaulein |
|---|---|
| Synonym | More Synonyms |
| Density | 1.452g/cm3 |
|---|---|
| Boiling Point | 546.3ºC at 760 mmHg |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25200 |
| Flash Point | 210.6ºC |
| Exact Mass | 288.06300 |
| PSA | 89.13000 |
| LogP | 2.37460 |
| Vapour Pressure | 1.51E-12mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | WYOSCUWDVFHQFY-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(=O)c3c(OC)c(O)ccc3oc2c1 |
| HS Code | 2932999099 |
|---|
|
~%
gentiacaulein CAS#:15402-27-4 |
| Literature: Pureb, O.; Zhim'vansan, Ya.; Oyuun, Kh. Chemistry of Natural Compounds, 1991 , vol. 27, # 2 p. 245 - 246 Khimiya Prirodnykh Soedinenii, 1991 , # 2 p. 284 - 285 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Getiacaulein |
| 2,8-dihydroxy-1,6-dimethoxy-9H-xanthen-9-one |
| 2,6-dimethoxyxanthone |
| 1,7-dihydroxy-3,8-dimethoxyxanthone |
| 2,8-dihydroxy-1,6-dimethoxyxanthen-9-one |
| 2,8-dihydroxy-1,6-dimethoxy-xanthen-9-one |
| 2,8-dihydroxy-1,6-dimethoxyxanthone |
| Gentiacaulein |
| HMS2227I16 |