tert-butyl 3-(4-(2-cyanoethynyl)phenylcarbamoyl)propylcarbamate
Modify Date: 2025-08-27 11:24:01
tert-butyl 3-(4-(2-cyanoethynyl)phenylcarbamoyl)propylcarbamate structure
|
Common Name | tert-butyl 3-(4-(2-cyanoethynyl)phenylcarbamoyl)propylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 1539292-60-8 | Molecular Weight | 327.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of tert-butyl 3-(4-(2-cyanoethynyl)phenylcarbamoyl)propylcarbamateAPN-C3-NH-Boc is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | APN-C3-NH-Boc |
|---|
| Description | APN-C3-NH-Boc is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C18H21N3O3 |
|---|---|
| Molecular Weight | 327.38 |
| InChIKey | AMGRZHJEZVBBHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)Nc1ccc(C#CC#N)cc1 |