[2S-(2α,5α,6β)]-3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, compound with α-phenylbenzylamine structure
|
Common Name | [2S-(2α,5α,6β)]-3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, compound with α-phenylbenzylamine | ||
|---|---|---|---|---|
| CAS Number | 1538-11-0 | Molecular Weight | 517.63900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H31N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzylpenicillin, salt with benzhydrylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C29H31N3O4S |
|---|---|
| Molecular Weight | 517.63900 |
| Exact Mass | 517.20400 |
| PSA | 138.03000 |
| LogP | 4.62460 |
| InChIKey | QCFJTUGHFMTKSB-LQDWTQKMSA-N |
| SMILES | CC1(C)SC2C(NC(=O)Cc3ccccc3)C(=O)N2C1C(=O)O.NC(c1ccccc1)c1ccccc1 |
| (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-phenylacetylamino-4-thia-1-aza-bicyclo[3.2.0]heptane-2-carboxylic acid |
| compound with C,C-diphenyl-methylamine |
| penicillin G benzhydrylamine |
| Benzylpenicillin, Salz mit Benzhydrylamin |
| (2S-(2α,5α,6β))-3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, compound with α-phenylbenzylamine |