PyOxim structure
|
Common Name | PyOxim | ||
|---|---|---|---|---|
| CAS Number | 153433-21-7 | Molecular Weight | 511.38200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H29F6N5O2P2 | Melting Point | 167-172°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | [(E)-(1-cyano-2-oxobutylidene)amino]oxy-tripyrrolidin-1-ylphosphanium,hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 167-172°C |
|---|---|
| Molecular Formula | C17H29F6N5O2P2 |
| Molecular Weight | 511.38200 |
| Exact Mass | 511.17000 |
| PSA | 99.35000 |
| LogP | 6.02278 |
| InChIKey | RDWDVLFMPFUBDV-JWJVXZKMSA-N |
| SMILES | CCOC(=O)C(C#N)=NO[P+](N1CCCC1)(N1CCCC1)N1CCCC1.F[P-](F)(F)(F)(F)F |
| Storage condition | 2-8°C |
| Supplemental HS | Risk of explosion if heated under confinement. |
|---|---|
| RIDADR | NONH for all modes of transport |
| PyOxim |
| [Ethyl cyano(hydroxyimino)acetato-O2]tri-1-pyrrolidinylphosphonium hexafluorophosphate |