p-Toluidine, a,a'-(propylenedinitrilo)bis[N,N-bis(2-chloroethyl)-(8CI) structure
|
Common Name | p-Toluidine, a,a'-(propylenedinitrilo)bis[N,N-bis(2-chloroethyl)-(8CI) | ||
|---|---|---|---|---|
| CAS Number | 15332-55-5 | Molecular Weight | 530.36000 | |
| Density | 1.19g/cm3 | Boiling Point | 648.2ºC at 760 mmHg | |
| Molecular Formula | C25H32Cl4N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.8ºC | |
| Name | 4,8-diamino-2-(4-ethoxyphenyl)-1,5-dihydroxyanthracene-9,10-dione |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 648.2ºC at 760 mmHg |
| Molecular Formula | C25H32Cl4N4 |
| Molecular Weight | 530.36000 |
| Flash Point | 345.8ºC |
| Exact Mass | 528.13800 |
| PSA | 31.20000 |
| LogP | 6.18110 |
| Vapour Pressure | 1.1E-16mmHg at 25°C |
| Index of Refraction | 1.564 |
|
~%
p-Toluidine, a,... CAS#:15332-55-5 |
| Literature: Nicole; Berlinguet Journal of medicinal chemistry, 1967 , vol. 10, # 2 p. 287 - 288 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |