LY306669 structure
|
Common Name | LY306669 | ||
|---|---|---|---|---|
| CAS Number | 153227-04-4 | Molecular Weight | 434.48200 | |
| Density | N/A | Boiling Point | 585.8ºC at 760 mmHg | |
| Molecular Formula | C23H28FN4NaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.1ºC | |
Use of LY306669LY306669 is a potent and selective leukotriene B4 (LTB4) receptor antagonist that can be used for the research of lung injury[1]. |
| Name | sodium,4-ethyl-2-(3-fluorophenyl)-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenolate |
|---|---|
| Synonym | More Synonyms |
| Description | LY306669 is a potent and selective leukotriene B4 (LTB4) receptor antagonist that can be used for the research of lung injury[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 585.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H28FN4NaO2 |
| Molecular Weight | 434.48200 |
| Flash Point | 308.1ºC |
| Exact Mass | 434.20900 |
| PSA | 86.75000 |
| LogP | 5.62900 |
| Vapour Pressure | 2.54E-14mmHg at 25°C |
| InChIKey | KZDVNZZCFSABBQ-UHFFFAOYSA-M |
| SMILES | CCc1cc(-c2cccc(F)c2)c([O-])cc1OCCCCCC(C)(C)c1nn[nH]n1.[Na+] |
| 5-Ethyl-3'-fluoro-4-((6-methyl-6-(1H-tetrazol-5-yl)heptyl)oxy)-(1,1'-bipenyl)-2-ol monosodium salt |
| (1,1'-Bipenyl)-2-ol,5-ethyl-3'-fluoro-4-((6-methyl-6-(1H-tetrazol-5-yl)heptyl)oxy)-,monosodium salt |