Diclofenac ethyl ester
Modify Date: 2025-08-25 12:20:24
Diclofenac ethyl ester structure
|
Common Name | Diclofenac ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 15307-77-4 | Molecular Weight | 281.10900 | |
| Density | 1.303g/cm3 | Boiling Point | 388ºC at 760 mmHg | |
| Molecular Formula | C10H9BrN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.4ºC | |
| Name | ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 388ºC at 760 mmHg |
| Molecular Formula | C10H9BrN4O |
| Molecular Weight | 281.10900 |
| Flash Point | 188.4ºC |
| Exact Mass | 279.99600 |
| PSA | 83.80000 |
| LogP | 2.53390 |
| Vapour Pressure | 3.17E-06mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | YPBCAMNSNFVYQL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 2-[(2,6-dichlorophenyl)amino]benzeneacetate |
| [o-(2,6-Dichloroanilino)phenyl]acetic Acid Ethyl Ester |
| Ethyl 2-(2,6-Dichloroanilino)phenylacetate |
| 2-[(2,6-Dichlorophenyl)amino]benzeneacetic Acid Ethyl Ester |
| Diclofenac Ethyl Ester |
| Aceclofenac Impurity 3 |