Clorindanic
Modify Date: 2025-09-20 19:39:41
Clorindanic structure
|
Common Name | Clorindanic | ||
|---|---|---|---|---|
| CAS Number | 153-43-5 | Molecular Weight | 212.63000 | |
| Density | 1.503g/cm3 | Boiling Point | 371ºC at 760mmHg | |
| Molecular Formula | C10H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.2ºC | |
| Name | 7-chloro-4-hydroxy-2,3-dihydro-1H-indene-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.503g/cm3 |
|---|---|
| Boiling Point | 371ºC at 760mmHg |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63000 |
| Flash Point | 178.2ºC |
| Exact Mass | 212.02400 |
| PSA | 57.53000 |
| LogP | 2.23250 |
| Vapour Pressure | 3.69E-06mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | UIEGCHMMGBNMIL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)c2c(c1O)CCC2 |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,3-Dihydro-7-chloro-4-hydroxy-1H-indene-5-carboxylic acid |
| Clorindanic Acid |
| Acido clorindanico [INN-Spanish] |
| Acide clorindanique [INN-French] |
| 7-Chloro-4-hydroxy-5-indancarboxylic acid |
| 7-chloro-4-hydroxyindane-5-carboxylic acid |
| Acidum clorindanicum [INN-Latin] |