(3,5-dimethylphenyl)methyl nitrate
Modify Date: 2025-08-25 15:15:07
(3,5-dimethylphenyl)methyl nitrate structure
|
Common Name | (3,5-dimethylphenyl)methyl nitrate | ||
|---|---|---|---|---|
| CAS Number | 15285-43-5 | Molecular Weight | 181.18900 | |
| Density | 1.15g/cm3 | Boiling Point | 272.9ºC at 760mmHg | |
| Molecular Formula | C9H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.1ºC | |
| Name | (3,5-dimethylphenyl)methyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 272.9ºC at 760mmHg |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.18900 |
| Flash Point | 120.1ºC |
| Exact Mass | 181.07400 |
| PSA | 55.05000 |
| LogP | 2.53490 |
| Vapour Pressure | 0.00989mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | CHDZRXQPKVNDRJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(CO[N+](=O)[O-])c1 |
|
~86%
(3,5-dimethylph... CAS#:15285-43-5 |
| Literature: Baciocchi, E.; Rol, C.; Sebastiani, G. V.; Serena, B. Tetrahedron Letters, 1984 , vol. 25, # 18 p. 1945 - 1946 |
|
~67%
(3,5-dimethylph... CAS#:15285-43-5 |
| Literature: Dinctuerk, Suphi; Ridd, John H. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1982 , p. 961 - 964 |
|
~%
(3,5-dimethylph... CAS#:15285-43-5 |
| Literature: Dinctuerk, Suphi; Ridd, John H. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1982 , p. 965 - 970 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 3,5-Dimethylbenzyl alcohol nitrate |
| Benzyl alcohol,3,5-dimethyl-,nitrate |
| 3,5-dimethylbenzyl nitrate |
| 3,5-Dimethyl-benzylnitrat |