Isophthalic acid diisobutyl ester
Modify Date: 2025-08-27 10:47:45
Isophthalic acid diisobutyl ester structure
|
Common Name | Isophthalic acid diisobutyl ester | ||
|---|---|---|---|---|
| CAS Number | 1528-64-9 | Molecular Weight | 278.34300 | |
| Density | 1.05g/cm3 | Boiling Point | 300.1ºC at 760 mmHg | |
| Molecular Formula | C16H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6ºC | |
| Name | bis(2-methylpropyl) benzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 300.1ºC at 760 mmHg |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.34300 |
| Flash Point | 156.6ºC |
| Exact Mass | 278.15200 |
| PSA | 52.60000 |
| LogP | 3.31220 |
| Vapour Pressure | 0.00114mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | LKUXNJPSPNDDLI-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)c1cccc(C(=O)OCC(C)C)c1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Isophthalsaeure-diisobutylester |
| Diisobutyl isophthalate |
| 1,3-Benzenedicarboxylic acid,bis(2-methylpropyl) ester |
| Isophthalsaeure-bis-isobutylester |
| ISOPHTHALIC ACID,DIISOBUTYL ESTER |