N-(2-Butenyl)-α-methyl-m-(trifluoromethyl)phenethylamine structure
|
Common Name | N-(2-Butenyl)-α-methyl-m-(trifluoromethyl)phenethylamine | ||
|---|---|---|---|---|
| CAS Number | 15270-45-8 | Molecular Weight | 257.29500 | |
| Density | 1.067g/cm3 | Boiling Point | 286.5ºC at 760mmHg | |
| Molecular Formula | C14H18F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.1ºC | |
| Name | (E)-N-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]but-2-en-1-amine |
|---|
| Density | 1.067g/cm3 |
|---|---|
| Boiling Point | 286.5ºC at 760mmHg |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.29500 |
| Flash Point | 127.1ºC |
| Exact Mass | 257.13900 |
| PSA | 12.03000 |
| LogP | 4.19300 |
| Vapour Pressure | 0.00263mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | MSWGGPYUPPKTIQ-ONEGZZNKSA-N |
| SMILES | CC=CCNC(C)Cc1cccc(C(F)(F)F)c1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |