2,4-bis(trifluoromethylsulfonyl)phenol structure
|
Common Name | 2,4-bis(trifluoromethylsulfonyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 15183-81-0 | Molecular Weight | 358.23500 | |
| Density | 1.754g/cm3 | Boiling Point | 421.4ºC at 760mmHg | |
| Molecular Formula | C8H4F6O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | 2,4-bis(trifluoromethylsulfonyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.754g/cm3 |
|---|---|
| Boiling Point | 421.4ºC at 760mmHg |
| Molecular Formula | C8H4F6O5S2 |
| Molecular Weight | 358.23500 |
| Flash Point | 208.6ºC |
| Exact Mass | 357.94000 |
| PSA | 105.27000 |
| LogP | 4.14080 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.46 |
| InChIKey | YLVSVWPYINMRPI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(O)c(S(=O)(=O)C(F)(F)F)c1)C(F)(F)F |
| HS Code | 2908999090 |
|---|
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,4-Bis-trifluormethylsulfonyl-phenol |
| 2,3-DIMETHYL-PYRIDIN-4-YLAMINE |