RU 58668
Modify Date: 2024-01-22 18:51:54
RU 58668 structure
|
Common Name | RU 58668 | ||
|---|---|---|---|---|
| CAS Number | 151555-47-4 | Molecular Weight | 658.75900 | |
| Density | 1.272g/cm3 | Boiling Point | 736.3ºC at 760mmHg | |
| Molecular Formula | C34H43F5O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 399.1ºC | |
Use of RU 58668RU58668 is a steroidal antiestrogen that can be used as a potent antiproliferative agent on MCF-7 cells. RU58668 has the potential for the breast cancer research[1]. |
| Name | (8S,9R,13S,14S,17S)-13-methyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| Synonym | More Synonyms |
| Description | RU58668 is a steroidal antiestrogen that can be used as a potent antiproliferative agent on MCF-7 cells. RU58668 has the potential for the breast cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 736.3ºC at 760mmHg |
| Molecular Formula | C34H43F5O5S |
| Molecular Weight | 658.75900 |
| Flash Point | 399.1ºC |
| Exact Mass | 658.27500 |
| PSA | 92.21000 |
| LogP | 9.02540 |
| Vapour Pressure | 9.2E-23mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | SDCUWFRXMLQNCS-LFAPAAFUSA-N |
| SMILES | CC12CC(c3ccc(OCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)cc3)C3c4ccc(O)cc4CCC3C1CCC2O |
| ru 58 668 |