Urea,N-(3,4-dichlorophenyl)-N'-(2-hydroxyethyl)- structure
|
Common Name | Urea,N-(3,4-dichlorophenyl)-N'-(2-hydroxyethyl)- | ||
|---|---|---|---|---|
| CAS Number | 15145-34-3 | Molecular Weight | 249.09400 | |
| Density | 1.471g/cm3 | Boiling Point | 376.4ºC at 760 mmHg | |
| Molecular Formula | C9H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4ºC | |
| Name | 1-(3,4-dichlorophenyl)-3-(2-hydroxyethyl)urea |
|---|
| Density | 1.471g/cm3 |
|---|---|
| Boiling Point | 376.4ºC at 760 mmHg |
| Molecular Formula | C9H10Cl2N2O2 |
| Molecular Weight | 249.09400 |
| Flash Point | 181.4ºC |
| Exact Mass | 248.01200 |
| PSA | 61.36000 |
| LogP | 2.57110 |
| Vapour Pressure | 2.47E-06mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | PJIXSUQUIZCQMO-UHFFFAOYSA-N |
| SMILES | O=C(NCCO)Nc1ccc(Cl)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |