5-[3-(Diethylamino)propoxy]-3-methyl-1-phenyl-1H-pyrazole structure
|
Common Name | 5-[3-(Diethylamino)propoxy]-3-methyl-1-phenyl-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 15083-54-2 | Molecular Weight | 287.40000 | |
| Density | 1.02g/cm3 | Boiling Point | 414.4ºC at 760mmHg | |
| Molecular Formula | C17H25N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.4ºC | |
| Name | N,N-diethyl-3-(5-methyl-2-phenylpyrazol-3-yl)oxypropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 414.4ºC at 760mmHg |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.40000 |
| Flash Point | 204.4ºC |
| Exact Mass | 287.20000 |
| PSA | 30.29000 |
| LogP | 3.29140 |
| Vapour Pressure | 4.46E-07mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | BXFMKJNALBPMFN-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCOc1cc(C)nn1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| p-330 |