[1-(3,5-dimethyl-2-oxo-cyclohexyl)-2-(2,6-dioxo-4-piperidyl)ethyl] acetate structure
|
Common Name | [1-(3,5-dimethyl-2-oxo-cyclohexyl)-2-(2,6-dioxo-4-piperidyl)ethyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 1508-62-9 | Molecular Weight | 323.38400 | |
| Density | 1.128g/cm3 | Boiling Point | 490.4ºC at 760mmHg | |
| Molecular Formula | C17H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.4ºC | |
| Name | [1-(3,5-dimethyl-2-oxocyclohexyl)-2-(2,6-dioxopiperidin-4-yl)ethyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 490.4ºC at 760mmHg |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.38400 |
| Flash Point | 250.4ºC |
| Exact Mass | 323.17300 |
| PSA | 93.03000 |
| LogP | 1.88820 |
| Vapour Pressure | 9.2E-10mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | AAQPOUCMFUHFNK-TXFQPVFDSA-N |
| SMILES | CC(=O)OC(CC1CC(=O)NC(=O)C1)C1CC(C)CC(C)C1=O |
|
~83%
[1-(3,5-dimethy... CAS#:1508-62-9 |
| Literature: Christner, Claudia; Wyrwa, Ralf; Marsch, Silvia; Kuellertz, Gerhard; Thiericke, Ralf; Grabley, Susanne; Schumann, Dieter; Fischer, Gunter Journal of Medicinal Chemistry, 1999 , vol. 42, # 18 p. 3615 - 3622 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| O-acetylcycloheximide |
| Cycloheximidacetat |