2,5-Cyclohexadien-1-one,2,6-bis(1,1-dimethylethyl)-4-(methyl-aci-nitro)- structure
|
Common Name | 2,5-Cyclohexadien-1-one,2,6-bis(1,1-dimethylethyl)-4-(methyl-aci-nitro)- | ||
|---|---|---|---|---|
| CAS Number | 15052-27-4 | Molecular Weight | 265.34800 | |
| Density | 1.03g/cm3 | Boiling Point | 349.4ºC at 760mmHg | |
| Molecular Formula | C15H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.3ºC | |
| Name | 3,5-ditert-butyl-N-methoxy-4-oxocyclohexa-2,5-dien-1-imine oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 349.4ºC at 760mmHg |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.34800 |
| Flash Point | 123.3ºC |
| Exact Mass | 265.16800 |
| PSA | 55.05000 |
| LogP | 3.55000 |
| Vapour Pressure | 4.72E-05mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | DDNMJFLOMBXHCP-UHFFFAOYSA-N |
| SMILES | CO[N+](=O)c1cc(C(C)(C)C)c([O-])c(C(C)(C)C)c1 |
|
~%
2,5-Cyclohexadi... CAS#:15052-27-4 |
| Literature: Meek,J.S.; Powler,J.S. Journal of Organic Chemistry, 1968 , vol. 33, p. 226 - 229 |
|
~%
2,5-Cyclohexadi... CAS#:15052-27-4 |
| Literature: Baldry, Peter J.; Forrester, Alexander R.; Ogilvy, Munro M.; Thomson, Ronald H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 9 p. 2035 - 2040 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| 3,5-Di-tert.-butyl-4-oxo-2,5-cyclohexadien-nitronsaeure-methylester |
| 4-Nitro-2,6-di-tert-butyl-phenol-aci-methylether |