α-Ethyl-α-(2-piperidinoethyl)-1-naphthaleneacetamide structure
|
Common Name | α-Ethyl-α-(2-piperidinoethyl)-1-naphthaleneacetamide | ||
|---|---|---|---|---|
| CAS Number | 1505-97-1 | Molecular Weight | 324.46000 | |
| Density | 1.09g/cm3 | Boiling Point | 543.2ºC at 760 mmHg | |
| Molecular Formula | C21H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.3ºC | |
| Name | 2-ethyl-2-naphthalen-1-yl-4-piperidin-1-ylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 543.2ºC at 760 mmHg |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.46000 |
| Flash Point | 282.3ºC |
| Exact Mass | 324.22000 |
| PSA | 47.32000 |
| LogP | 4.93650 |
| Vapour Pressure | 7.31E-12mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | QNZBHXVTDNAOEC-UHFFFAOYSA-N |
| SMILES | CCC(CCN1CCCCC1)(C(N)=O)c1cccc2ccccc12 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-ethyl-2-naphthalen-1-yl-4-piperidin-1-yl-butyramide |