10-[3-(4-Phenyl-piperidin-1-yl)-propyl]-10H-phenothiazine; compound with succinic acid structure
|
Common Name | 10-[3-(4-Phenyl-piperidin-1-yl)-propyl]-10H-phenothiazine; compound with succinic acid | ||
|---|---|---|---|---|
| CAS Number | 15037-50-0 | Molecular Weight | 518.66700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H34N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-[3-(4-Phenyl-piperidin-1-yl)-propyl]-10H-phenothiazine; compound with succinic acid |
|---|
| Molecular Formula | C30H34N2O4S |
|---|---|
| Molecular Weight | 518.66700 |
| Exact Mass | 518.22400 |
| PSA | 106.38000 |
| LogP | 6.49770 |
| InChIKey | NTSGGDGLMBAGEN-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)O.c1ccc(C2CCN(CCCN3c4ccccc4Sc4ccccc43)CC2)cc1 |