2-(2-fluoro-6-methoxyphenyl)pyrimidine-4-carboxylic acid structure
|
Common Name | 2-(2-fluoro-6-methoxyphenyl)pyrimidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1502645-66-0 | Molecular Weight | 248.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-(2-fluoro-6-methoxyphenyl)pyrimidine-4-carboxylic acid2-(2-fluoro-6-methoxyphenyl)pyrimidine-4-carboxylic acid is commonly used to synthesize compounds with anticancer and antitumor properties. |
| Name | 2-(2-fluoro-6-methoxyphenyl)pyrimidine-4-carboxylic acid |
|---|
| Description | 2-(2-fluoro-6-methoxyphenyl)pyrimidine-4-carboxylic acid is commonly used to synthesize compounds with anticancer and antitumor properties. |
|---|---|
| References | 1. Vechorkin, et al. Preparation of N-(phenyl)-2-(phenyl)pyrimidine-4-carboxamide derivatives and related compounds as HPK1 inhibitors for treating cancer. WO2019164846A1. |
| Molecular Formula | C12H9FN2O3 |
|---|---|
| Molecular Weight | 248.21 |
| InChIKey | MJZGEBOITRQAIO-UHFFFAOYSA-N |
| SMILES | COc1cccc(F)c1-c1nccc(C(=O)O)n1 |