5-[(Ethoxycarbonyl)amino]-1,2,4-thiadiazole-3-acetic acid methyl ester structure
|
Common Name | 5-[(Ethoxycarbonyl)amino]-1,2,4-thiadiazole-3-acetic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 150215-07-9 | Molecular Weight | 245.25600 | |
| Density | 1.408g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H11N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.408g/cm3 |
|---|---|
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.25600 |
| Exact Mass | 245.04700 |
| PSA | 118.65000 |
| LogP | 0.89500 |
| Index of Refraction | 1.574 |
| InChIKey | WRUIUWMHBQJODA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1nc(CC(=O)OC)ns1 |
|
~80%
5-[(Ethoxycarbo... CAS#:150215-07-9 |
| Literature: Katayama Seiyakusyo Co. Ltd. Patent: US5585494 A1, 1996 ; |
|
~%
5-[(Ethoxycarbo... CAS#:150215-07-9 |
| Literature: US6723716 B1, ; |
|
~83%
5-[(Ethoxycarbo... CAS#:150215-07-9 |
| Literature: Tatsuta, Kuniaki; Miura, Shozo; Gunji, Hiroki; Tamai, Tetsuro; Yoshida, Ryonosuke; Inagaki, Takashi Tetrahedron Letters, 1993 , vol. 34, # 40 p. 6423 - 6426 |
|
~%
5-[(Ethoxycarbo... CAS#:150215-07-9 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 67, # 6 p. 1701 - 1707 |
|
~%
5-[(Ethoxycarbo... CAS#:150215-07-9 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 67, # 6 p. 1701 - 1707 |
| methyl 2-(5-ethoxycarbonylamino-1,2,4-thiadiazol-3-yl)acetate |