6-Carboxyfluorescein 3’,6’-Diacetate N-Succinimidyl Ester structure
|
Common Name | 6-Carboxyfluorescein 3’,6’-Diacetate N-Succinimidyl Ester | ||
|---|---|---|---|---|
| CAS Number | 150206-15-8 | Molecular Weight | 557.461 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 765.4±70.0 °C at 760 mmHg | |
| Molecular Formula | C29H19NO11 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 416.7±35.7 °C | |
| Name | 6-Carboxyfluorescein 3’,6’-Diacetate N-Succinimidyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 765.4±70.0 °C at 760 mmHg |
| Molecular Formula | C29H19NO11 |
| Molecular Weight | 557.461 |
| Flash Point | 416.7±35.7 °C |
| Exact Mass | 557.095825 |
| PSA | 151.81000 |
| LogP | 0.50 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | JGPOSNWWINVNFV-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1cc(OC(C)=O)ccc1C21OC(=O)c2ccc(C(=O)ON3C(=O)CCC3=O)cc21 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
A Novel Method for Continuous Determination of the Intracellular pH in Bacteria with the Internally Conjugated Fluorescent Probe 5 (and 6-)-Carboxyfluorescein Succinimidyl Ester.
Appl. Environ. Microbiol. 62 , 178, (1996) A novel method based on the intracellular conjugation of the fluorescent probe 5 (and 6-)-carboxyfluorescein succinimidyl ester (cFSE) was developed to determine the intracellular pH of bacteria. cFSE... |
|
|
Optimization of 5-(and-6)-carboxyfluorescein diacetate succinimidyl ester for labeling human intervertebral disc cells in vitro.
Biotech. Histochem. 75 , 118, (2000) We have assessed the utility of an intracellular fluorochrome, 5-(and-6)-carboxyfluorescein diacetate succinimidyl ester (CFSE), as a tracking label for human intervertebral disc cells in vitro. Altho... |
| 2,5-Pyrrolidinedione, 1-[[[3',6'-bis(acetyloxy)-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-6-yl]carbonyl]oxy]- |
| 6-{[(2,5-Dioxo-1-pyrrolidinyl)oxy]carbonyl}-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diyl diacetate |
| 6-Carboxyfluorescein 3',6'-Diacetate N-Succinimidyl Ester |
| Carboxyfluorescein diacetate succinimidyl ester |
| 6-CFDA,SE [6-Carboxyfluorescein diacetate succinimidyl ester] |
| 6-{[(2,5-Dioxopyrrolidin-1-yl)oxy]carbonyl}-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diyl diacetate |
| 6-Carboxy-fluorescein diacetate N-succinimidyl ester |
| 6-Carboxy-di-O-acetylfluorescein N-succinimidyl ester |
| 6-CFDA N-succinimidyl ester |