5-Chloro-3-pyridinyl trifluoromethanesulfonate structure
|
Common Name | 5-Chloro-3-pyridinyl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 150145-19-0 | Molecular Weight | 261.606 | |
| Density | 1.7±0.0 g/cm3 | Boiling Point | 285.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C6H3ClF3NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.4±0.0 °C | |
| Name | (5-chloropyridin-3-yl) trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.0 g/cm3 |
|---|---|
| Boiling Point | 285.5±0.0 °C at 760 mmHg |
| Molecular Formula | C6H3ClF3NO3S |
| Molecular Weight | 261.606 |
| Flash Point | 126.4±0.0 °C |
| Exact Mass | 260.947418 |
| PSA | 64.64000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | JJLIHTCEFNQHGH-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1cncc(Cl)c1)C(F)(F)F |
|
~94%
5-Chloro-3-pyri... CAS#:150145-19-0 |
| Literature: ELI LILLY AND COMPANY Patent: WO2005/94822 A1, 2005 ; Location in patent: Page/Page column 37 ; WO 2005/094822 A1 |
|
~60%
5-Chloro-3-pyri... CAS#:150145-19-0 |
| Literature: Cosford, Nicholas D.; Roppe, Jeffrey R.; Tehrani, Lida R.; Smith, Nicholas D.; Stearns, Brian; Huang, Dehua; Wang, Bowei Patent: US2005/43307 A1, 2005 ; |
|
~%
5-Chloro-3-pyri... CAS#:150145-19-0 |
| Literature: Merck and Co., Inc. Patent: US6642237 B1, 2003 ; Location in patent: Page/Page column 157 ; |
| Methanesulfonic acid,trifluoro-,5-chloro-3-pyridinyl ester |
| trifluoromethanesulfonic acid 5-chloro-3-pyridinyl ester |
| 5-chloropyridin-3-yl trifluoromethanesulfonate |
| 5-Chloro-3-pyridinyl trifluoromethanesulfonate |
| Methanesulfonic acid, 1,1,1-trifluoro-, 5-chloro-3-pyridinyl ester |
| trifluoromethanesulfonic acid 5-chloropyridin-3-yl ester |