2-Cyclohexen-1-one,3-(cyclohexylamino)-5,5-dimethyl- structure
|
Common Name | 2-Cyclohexen-1-one,3-(cyclohexylamino)-5,5-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 1500-76-1 | Molecular Weight | 221.33900 | |
| Density | 1g/cm3 | Boiling Point | 336.5ºC at 760mmHg | |
| Molecular Formula | C14H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.6ºC | |
| Name | 3-(cyclohexylamino)-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 336.5ºC at 760mmHg |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.33900 |
| Flash Point | 119.6ºC |
| Exact Mass | 221.17800 |
| PSA | 29.10000 |
| LogP | 3.57260 |
| Vapour Pressure | 0.000112mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | BBRPUCDNSTWJAG-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C=C(NC2CCCCC2)C1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Cyclohexylamino-5,5-dimethyl-cyclohex-2-en-1-on |
| 3-Cyclohexylamino-5,5-dimethyl-2-cyclohexen-1-on |
| 5,5-Dimethyl-3-(N-cyclohexylamino)-cyclohex-2-en-1-one |