1-methyl-5-nitro-4-phenylimidazole structure
|
Common Name | 1-methyl-5-nitro-4-phenylimidazole | ||
|---|---|---|---|---|
| CAS Number | 14953-63-0 | Molecular Weight | 203.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-5-nitro-4-phenylimidazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9N3O2 |
|---|---|
| Molecular Weight | 203.19700 |
| Exact Mass | 203.06900 |
| PSA | 63.64000 |
| LogP | 2.51850 |
| InChIKey | XRSIQFNWEQMSHI-UHFFFAOYSA-N |
| SMILES | Cn1cnc(-c2ccccc2)c1[N+](=O)[O-] |
|
~5%
1-methyl-5-nitr... CAS#:14953-63-0 |
| Literature: Ehlhardt, William J.; Beaulieu, Bernard B.; Goldman, Peter Journal of Medicinal Chemistry, 1988 , vol. 31, # 2 p. 323 - 329 |
|
~%
1-methyl-5-nitr... CAS#:14953-63-0 |
| Literature: Ehlhardt, William J.; Beaulieu, Bernard B.; Goldman, Peter Journal of Medicinal Chemistry, 1988 , vol. 31, # 2 p. 323 - 329 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1H-Imidazole,1-methyl-5-nitro-4-phenyl |
| 1-Methyl-5-nitro-4-phenyl-1H-imidazole |
| 1-Methyl-4-phenyl-5-nitroimidazole |