4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate
Modify Date: 2025-09-13 12:09:04
4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate structure
|
Common Name | 4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate | ||
|---|---|---|---|---|
| CAS Number | 14943-53-4 | Molecular Weight | 351.43900 | |
| Density | 1.134g/cm3 | Boiling Point | 447ºC at 760 mmHg | |
| Molecular Formula | C22H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.1ºC | |
| Name | 4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 447ºC at 760 mmHg |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.43900 |
| Flash Point | 224.1ºC |
| Exact Mass | 351.18300 |
| PSA | 49.77000 |
| LogP | 2.81090 |
| Vapour Pressure | 8.99E-09mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | YGGLNZUXAWIXQH-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC#CCOC(=O)C(O)(c1ccccc1)c1ccccc1 |
| Benzilsaeure-<4-diaethylamino-but-2-in-1-yl-ester> |
| |A-Descyclohexyl-|A-phenyl Oxybutynin |
| UNII-Q22UJW0W32 |
| Diphenyl analogue of oxybutynin |
| 4-Diaethylamino-2-butinylbenzilat |