1,3-bis(4-fluorophenyl)-1,3-Propanedione structure
|
Common Name | 1,3-bis(4-fluorophenyl)-1,3-Propanedione | ||
|---|---|---|---|---|
| CAS Number | 1493-51-2 | Molecular Weight | 260.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(4-fluorophenyl)-1,3-Propanedione |
|---|
| Molecular Formula | C15H10F2O2 |
|---|---|
| Molecular Weight | 260.23600 |
| Exact Mass | 260.06500 |
| PSA | 34.14000 |
| LogP | 3.42050 |
| Vapour Pressure | 1.11E-06mmHg at 25°C |
| InChIKey | MMDLTXGEZNHAOV-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |