1-[(4-chlorophenyl)methyl]-3-(3,4-dichlorophenyl)-1-methoxyurea structure
|
Common Name | 1-[(4-chlorophenyl)methyl]-3-(3,4-dichlorophenyl)-1-methoxyurea | ||
|---|---|---|---|---|
| CAS Number | 149282-25-7 | Molecular Weight | 359.63500 | |
| Density | 1.443g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H13Cl3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(4-chlorophenyl)methyl]-3-(3,4-dichlorophenyl)-1-methoxyurea |
|---|
| Density | 1.443g/cm3 |
|---|---|
| Molecular Formula | C15H13Cl3N2O2 |
| Molecular Weight | 359.63500 |
| Exact Mass | 358.00400 |
| PSA | 41.57000 |
| LogP | 5.31530 |
| Index of Refraction | 1.64 |
| InChIKey | UAOLDMOQMUEJFT-UHFFFAOYSA-N |
| SMILES | CON(Cc1ccc(Cl)cc1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |